C22H28O4S — CID 10927218
[2-(benzenesulfonyl)-1,2-di(cyclohexen-1-yl)ethyl] acetate (PubChem CID 10927218) has the molecular formula C22H28O4S and a molecular weight of 388.53 g/mol. Its IUPAC name is [2-(benzenesulfonyl)-1,2-di(cyclohexen-1-yl)ethyl] acetate.
| Compound Name | [2-(benzenesulfonyl)-1,2-di(cyclohexen-1-yl)ethyl] acetate |
|---|---|
| PubChem CID | 10927218 |
| Molecular Formula | C22H28O4S |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | [2-(benzenesulfonyl)-1,2-di(cyclohexen-1-yl)ethyl] acetate |
| SMILES | CC(=O)OC(C1=CCCCC1)C(C1=CCCCC1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H28O4S/c1-17(23)26-21(18-11-5-2-6-12-18)22(19-13-7-3-8-14-19)27(24,25)20-15-9-4-10-16-20/h4,9-11,13,15-16,21-22H,2-3,5-8,12,14H2,1H3 |
| InChIKey | CMHARZPEBIWXRN-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|