C22H20O4S — CID 13265386
[(1R,2S)-2-(benzenesulfonyl)-1,2-diphenylethyl] acetate (PubChem CID 13265386) has the molecular formula C22H20O4S and a molecular weight of 380.47 g/mol. Its IUPAC name is [(1R,2S)-2-(benzenesulfonyl)-1,2-diphenylethyl] acetate.
| Compound Name | [(1R,2S)-2-(benzenesulfonyl)-1,2-diphenylethyl] acetate |
|---|---|
| PubChem CID | 13265386 |
| Molecular Formula | C22H20O4S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | [(1R,2S)-2-(benzenesulfonyl)-1,2-diphenylethyl] acetate |
| SMILES | CC(=O)O[C@H](c1ccccc1)[C@H](c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H20O4S/c1-17(23)26-21(18-11-5-2-6-12-18)22(19-13-7-3-8-14-19)27(24,25)20-15-9-4-10-16-20/h2-16,21-22H,1H3/t21-,22+/m1/s1 |
| InChIKey | ZTPCADFYSLZHBE-YADHBBJMSA-N |
| XLogP | 4.51 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |