C32H46O6S — CID 13265407
methyl (2E,6E)-9-(benzenesulfonyl)-3,7-dimethyl-8-(oxan-2-yloxy)-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6-dienoate (PubChem CID 13265407) has the molecular formula C32H46O6S and a molecular weight of 558.78 g/mol. Its IUPAC name is methyl (2E,6E)-9-(benzenesulfonyl)-3,7-dimethyl-8-(oxan-2-yloxy)-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6-dienoate.
| Compound Name | methyl (2E,6E)-9-(benzenesulfonyl)-3,7-dimethyl-8-(oxan-2-yloxy)-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6-dienoate |
|---|---|
| PubChem CID | 13265407 |
| Molecular Formula | C32H46O6S |
| Molecular Weight | 558.78 g/mol |
| Exact Mass | 558.30 |
| IUPAC Name | methyl (2E,6E)-9-(benzenesulfonyl)-3,7-dimethyl-8-(oxan-2-yloxy)-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6-dienoate |
| SMILES | COC(=O)/C=C(\C)CC/C=C(\C)C(OC1CCCCO1)C(C1=C(C)CCCC1(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C32H46O6S/c1-23(22-27(33)36-6)14-12-15-25(3)30(38-28-19-10-11-21-37-28)31(29-24(2)16-13-20-32(29,4)5)39(34,35)26-17-8-7-9-18-26/h7-9,15,17-18,22,28,30-31H,10-14,16,19-21H2,1-6H3/b23-22+,25-15+ |
| InChIKey | TXINLENCHVANGM-HCYCSIGCSA-N |
| XLogP | 7.11 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.78 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|