C28H38O4S — CID 132521797
[(2S,4aS,7R)-7-[4-(benzenesulfonyl)-6-methylhepta-1,5-dien-2-yl]-1,4a-dimethyl-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-yl] acetate (PubChem CID 132521797) has the molecular formula C28H38O4S and a molecular weight of 470.68 g/mol. Its IUPAC name is [(2S,4aS,7R)-7-[4-(benzenesulfonyl)-6-methylhepta-1,5-dien-2-yl]-1,4a-dimethyl-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-yl] acetate.
| Compound Name | [(2S,4aS,7R)-7-[4-(benzenesulfonyl)-6-methylhepta-1,5-dien-2-yl]-1,4a-dimethyl-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-yl] acetate |
|---|---|
| PubChem CID | 132521797 |
| Molecular Formula | C28H38O4S |
| Molecular Weight | 470.68 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | [(2S,4aS,7R)-7-[4-(benzenesulfonyl)-6-methylhepta-1,5-dien-2-yl]-1,4a-dimethyl-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-yl] acetate |
| SMILES | C=C(CC(C=C(C)C)S(=O)(=O)c1ccccc1)[C@@H]1CC[C@@]2(C)CC[C@H](OC(C)=O)C(C)=C2C1 |
| InChI | InChI=1S/C28H38O4S/c1-19(2)16-25(33(30,31)24-10-8-7-9-11-24)17-20(3)23-12-14-28(6)15-13-27(32-22(5)29)21(4)26(28)18-23/h7-11,16,23,25,27H,3,12-15,17-18H2,1-2,4-6H3/t23-,25?,27+,28+/m1/s1 |
| InChIKey | FXQTZBZXMGCMHG-IERJNEOLSA-N |
| XLogP | 6.59 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.68 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|