C33H48O6S — CID 15614577
[(2E,6E)-9-(benzenesulfonyl)-3,7-dimethyl-8-(oxan-2-yloxy)-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6-dienyl] acetate (PubChem CID 15614577) has the molecular formula C33H48O6S and a molecular weight of 572.81 g/mol. Its IUPAC name is [(2E,6E)-9-(benzenesulfonyl)-3,7-dimethyl-8-(oxan-2-yloxy)-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6-dienyl] acetate.
| Compound Name | [(2E,6E)-9-(benzenesulfonyl)-3,7-dimethyl-8-(oxan-2-yloxy)-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6-dienyl] acetate |
|---|---|
| PubChem CID | 15614577 |
| Molecular Formula | C33H48O6S |
| Molecular Weight | 572.81 g/mol |
| Exact Mass | 572.32 |
| IUPAC Name | [(2E,6E)-9-(benzenesulfonyl)-3,7-dimethyl-8-(oxan-2-yloxy)-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6-dienyl] acetate |
| SMILES | CC(=O)OC/C=C(\C)CC/C=C(\C)C(OC1CCCCO1)C(C1=C(C)CCCC1(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C33H48O6S/c1-24(20-23-37-27(4)34)14-12-15-26(3)31(39-29-19-10-11-22-38-29)32(30-25(2)16-13-21-33(30,5)6)40(35,36)28-17-8-7-9-18-28/h7-9,15,17-18,20,29,31-32H,10-14,16,19,21-23H2,1-6H3/b24-20+,26-15+ |
| InChIKey | LLKSFPSETTUVEV-SCKDVEMDSA-N |
| XLogP | 7.50 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.81 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|