C19H26O6S — CID 134886786
methyl (E,4S)-4-methyl-5-(4-methylphenyl)sulfonyl-4-(oxan-2-yloxy)pent-2-enoate (PubChem CID 134886786) has the molecular formula C19H26O6S and a molecular weight of 382.48 g/mol. Its IUPAC name is methyl (E,4S)-4-methyl-5-(4-methylphenyl)sulfonyl-4-(oxan-2-yloxy)pent-2-enoate.
| Compound Name | methyl (E,4S)-4-methyl-5-(4-methylphenyl)sulfonyl-4-(oxan-2-yloxy)pent-2-enoate |
|---|---|
| PubChem CID | 134886786 |
| Molecular Formula | C19H26O6S |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | methyl (E,4S)-4-methyl-5-(4-methylphenyl)sulfonyl-4-(oxan-2-yloxy)pent-2-enoate |
| SMILES | COC(=O)/C=C/[C@@](C)(CS(=O)(=O)c1ccc(C)cc1)OC1CCCCO1 |
| InChI | InChI=1S/C19H26O6S/c1-15-7-9-16(10-8-15)26(21,22)14-19(2,12-11-17(20)23-3)25-18-6-4-5-13-24-18/h7-12,18H,4-6,13-14H2,1-3H3/b12-11+/t18?,19-/m0/s1 |
| InChIKey | XPRUTJMXTXEAER-OVSRRAAISA-N |
| XLogP | 2.80 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|