C19H28O5S — CID 73075806
tert-butyl 4,4-diethoxy-2-(4-methylphenyl)sulfinylbut-2-enoate (PubChem CID 73075806) has the molecular formula C19H28O5S and a molecular weight of 368.50 g/mol. Its IUPAC name is tert-butyl 4,4-diethoxy-2-(4-methylphenyl)sulfinylbut-2-enoate.
| Compound Name | tert-butyl 4,4-diethoxy-2-(4-methylphenyl)sulfinylbut-2-enoate |
|---|---|
| PubChem CID | 73075806 |
| Molecular Formula | C19H28O5S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | tert-butyl 4,4-diethoxy-2-(4-methylphenyl)sulfinylbut-2-enoate |
| SMILES | CCOC(C=C(C(=O)OC(C)(C)C)S(=O)c1ccc(C)cc1)OCC |
| InChI | InChI=1S/C19H28O5S/c1-7-22-17(23-8-2)13-16(18(20)24-19(4,5)6)25(21)15-11-9-14(3)10-12-15/h9-13,17H,7-8H2,1-6H3 |
| InChIKey | VYDNOWIQQKNOKQ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|