C16H22O5S — CID 102573431
methyl (E)-4,4-diethoxy-2-(4-methylphenyl)sulfinylbut-2-enoate (PubChem CID 102573431) has the molecular formula C16H22O5S and a molecular weight of 326.41 g/mol. Its IUPAC name is methyl (E)-4,4-diethoxy-2-(4-methylphenyl)sulfinylbut-2-enoate.
| Compound Name | methyl (E)-4,4-diethoxy-2-(4-methylphenyl)sulfinylbut-2-enoate |
|---|---|
| PubChem CID | 102573431 |
| Molecular Formula | C16H22O5S |
| Molecular Weight | 326.41 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | methyl (E)-4,4-diethoxy-2-(4-methylphenyl)sulfinylbut-2-enoate |
| SMILES | CCOC(/C=C(\C(=O)OC)S(=O)c1ccc(C)cc1)OCC |
| InChI | InChI=1S/C16H22O5S/c1-5-20-15(21-6-2)11-14(16(17)19-4)22(18)13-9-7-12(3)8-10-13/h7-11,15H,5-6H2,1-4H3/b14-11+ |
| InChIKey | UAUNWTPFQCVCQE-SDNWHVSQSA-N |
| XLogP | 2.56 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|