C32H48O4SSi — CID 133083315
2-[[(7E,11S,12R)-10-(benzenesulfonyl)-4,8,11,12-tetramethyl-15-methylidene-2-bicyclo[9.3.1]pentadeca-1(14),3,7-trienyl]oxymethoxy]ethyl-trimethylsilane (PubChem CID 133083315) has the molecular formula C32H48O4SSi and a molecular weight of 556.89 g/mol. Its IUPAC name is 2-[[(7E,11S,12R)-10-(benzenesulfonyl)-4,8,11,12-tetramethyl-15-methylidene-2-bicyclo[9.3.1]pentadeca-1(14),3,7-trienyl]oxymethoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[(7E,11S,12R)-10-(benzenesulfonyl)-4,8,11,12-tetramethyl-15-methylidene-2-bicyclo[9.3.1]pentadeca-1(14),3,7-trienyl]oxymethoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 133083315 |
| Molecular Formula | C32H48O4SSi |
| Molecular Weight | 556.89 g/mol |
| Exact Mass | 556.30 |
| IUPAC Name | 2-[[(7E,11S,12R)-10-(benzenesulfonyl)-4,8,11,12-tetramethyl-15-methylidene-2-bicyclo[9.3.1]pentadeca-1(14),3,7-trienyl]oxymethoxy]ethyl-trimethylsilane |
| SMILES | C=C1C2=CC[C@@H](C)[C@]1(C)C(S(=O)(=O)c1ccccc1)C/C(C)=C/CCC(C)=CC2OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C32H48O4SSi/c1-24-13-12-14-25(2)22-31(37(33,34)28-15-10-9-11-16-28)32(5)26(3)17-18-29(27(32)4)30(21-24)36-23-35-19-20-38(6,7)8/h9-11,14-16,18,21,26,30-31H,4,12-13,17,19-20,22-23H2,1-3,5-8H3/b24-21?,25-14+/t26-,30?,31?,32+/m1/s1 |
| InChIKey | HWSLWIIHGKDDER-DRGRJCBHSA-N |
| XLogP | 8.13 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.89 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|