C32H49BrO4SSi — CID 155934913
2-[[(2E,6E)-1-[(4R,5S)-5-(benzenesulfonylmethyl)-4,5-dimethyl-6-methylidenecyclohexen-1-yl]-8-bromo-3,7-dimethylocta-2,6-dienoxy]methoxy]ethyl-trimethylsilane (PubChem CID 155934913) has the molecular formula C32H49BrO4SSi and a molecular weight of 637.80 g/mol. Its IUPAC name is 2-[[(2E,6E)-1-[(4R,5S)-5-(benzenesulfonylmethyl)-4,5-dimethyl-6-methylidenecyclohexen-1-yl]-8-bromo-3,7-dimethylocta-2,6-dienoxy]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[(2E,6E)-1-[(4R,5S)-5-(benzenesulfonylmethyl)-4,5-dimethyl-6-methylidenecyclohexen-1-yl]-8-bromo-3,7-dimethylocta-2,6-dienoxy]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 155934913 |
| Molecular Formula | C32H49BrO4SSi |
| Molecular Weight | 637.80 g/mol |
| Exact Mass | 636.23 |
| IUPAC Name | 2-[[(2E,6E)-1-[(4R,5S)-5-(benzenesulfonylmethyl)-4,5-dimethyl-6-methylidenecyclohexen-1-yl]-8-bromo-3,7-dimethylocta-2,6-dienoxy]methoxy]ethyl-trimethylsilane |
| SMILES | C=C1C(C(/C=C(\C)CC/C=C(\C)CBr)OCOCC[Si](C)(C)C)=CC[C@@H](C)[C@]1(C)CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C32H49BrO4SSi/c1-25(13-12-14-26(2)22-33)21-31(37-24-36-19-20-39(6,7)8)30-18-17-27(3)32(5,28(30)4)23-38(34,35)29-15-10-9-11-16-29/h9-11,14-16,18,21,27,31H,4,12-13,17,19-20,22-24H2,1-3,5-8H3/b25-21+,26-14+/t27-,31?,32+/m1/s1 |
| InChIKey | LHAZQQXPXIRBMT-NEIFSATLSA-N |
| XLogP | 8.75 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.80 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|