C30H46O7S2Si — CID 11444881
[(E,2R,3S)-9-(benzenesulfonyl)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-3,7-dimethylnon-6-enyl] 4-methylbenzenesulfonate (PubChem CID 11444881) has the molecular formula C30H46O7S2Si and a molecular weight of 610.91 g/mol. Its IUPAC name is [(E,2R,3S)-9-(benzenesulfonyl)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-3,7-dimethylnon-6-enyl] 4-methylbenzenesulfonate.
| Compound Name | [(E,2R,3S)-9-(benzenesulfonyl)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-3,7-dimethylnon-6-enyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11444881 |
| Molecular Formula | C30H46O7S2Si |
| Molecular Weight | 610.91 g/mol |
| Exact Mass | 610.25 |
| IUPAC Name | [(E,2R,3S)-9-(benzenesulfonyl)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-3,7-dimethylnon-6-enyl] 4-methylbenzenesulfonate |
| SMILES | C/C(=C\CC[C@](C)(O)[C@@H](COS(=O)(=O)c1ccc(C)cc1)O[Si](C)(C)C(C)(C)C)CCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C30H46O7S2Si/c1-24(20-22-38(32,33)26-14-10-9-11-15-26)13-12-21-30(6,31)28(37-40(7,8)29(3,4)5)23-36-39(34,35)27-18-16-25(2)17-19-27/h9-11,13-19,28,31H,12,20-23H2,1-8H3/b24-13+/t28-,30+/m1/s1 |
| InChIKey | MRBBQUZIHVVAOW-YQJLYGDESA-N |
| XLogP | 6.43 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.91 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|