C21H34O6SSi — CID 140658604
[(E,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-methyl-6-(4-methylphenyl)sulfonyloxyhex-1-enyl] formate (PubChem CID 140658604) has the molecular formula C21H34O6SSi and a molecular weight of 442.65 g/mol. Its IUPAC name is [(E,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-methyl-6-(4-methylphenyl)sulfonyloxyhex-1-enyl] formate.
| Compound Name | [(E,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-methyl-6-(4-methylphenyl)sulfonyloxyhex-1-enyl] formate |
|---|---|
| PubChem CID | 140658604 |
| Molecular Formula | C21H34O6SSi |
| Molecular Weight | 442.65 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | [(E,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-methyl-6-(4-methylphenyl)sulfonyloxyhex-1-enyl] formate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H](C)[C@H](C/C=C/OC=O)O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H34O6SSi/c1-17-10-12-19(13-11-17)28(23,24)26-15-18(2)20(9-8-14-25-16-22)27-29(6,7)21(3,4)5/h8,10-14,16,18,20H,9,15H2,1-7H3/b14-8+/t18-,20-/m0/s1 |
| InChIKey | LYKXPJCZVQTCHI-OHQQYLRVSA-N |
| XLogP | 4.80 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.65 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|