C22H32O5SSi — CID 72712609
[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-3-(4-hydroxyphenyl)propyl] 4-methylbenzenesulfonate (PubChem CID 72712609) has the molecular formula C22H32O5SSi and a molecular weight of 436.65 g/mol. Its IUPAC name is [(2R)-2-[tert-butyl(dimethyl)silyl]oxy-3-(4-hydroxyphenyl)propyl] 4-methylbenzenesulfonate.
| Compound Name | [(2R)-2-[tert-butyl(dimethyl)silyl]oxy-3-(4-hydroxyphenyl)propyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 72712609 |
| Molecular Formula | C22H32O5SSi |
| Molecular Weight | 436.65 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | [(2R)-2-[tert-butyl(dimethyl)silyl]oxy-3-(4-hydroxyphenyl)propyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H](Cc2ccc(O)cc2)O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H32O5SSi/c1-17-7-13-21(14-8-17)28(24,25)26-16-20(27-29(5,6)22(2,3)4)15-18-9-11-19(23)12-10-18/h7-14,20,23H,15-16H2,1-6H3/t20-/m1/s1 |
| InChIKey | ITIPQUAKGFIYFX-HXUWFJFHSA-N |
| XLogP | 5.04 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.65 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|