C20H24O3S — CID 11279388
(5-methyl-2-phenylhex-4-enyl) 4-methylbenzenesulfonate (PubChem CID 11279388) has the molecular formula C20H24O3S and a molecular weight of 344.48 g/mol. Its IUPAC name is (5-methyl-2-phenylhex-4-enyl) 4-methylbenzenesulfonate.
| Compound Name | (5-methyl-2-phenylhex-4-enyl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11279388 |
| Molecular Formula | C20H24O3S |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | (5-methyl-2-phenylhex-4-enyl) 4-methylbenzenesulfonate |
| SMILES | CC(C)=CCC(COS(=O)(=O)c1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H24O3S/c1-16(2)9-12-19(18-7-5-4-6-8-18)15-23-24(21,22)20-13-10-17(3)11-14-20/h4-11,13-14,19H,12,15H2,1-3H3 |
| InChIKey | LWTQSPPKDOKTAY-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|