C29H42O6S — CID 11168320
[(2E,6E)-9-[2-(benzenesulfonyl)acetyl]-2,6,9,13-tetramethyl-12-methylidenetetradeca-2,6-dienyl] methyl carbonate (PubChem CID 11168320) has the molecular formula C29H42O6S and a molecular weight of 518.72 g/mol. Its IUPAC name is [(2E,6E)-9-[2-(benzenesulfonyl)acetyl]-2,6,9,13-tetramethyl-12-methylidenetetradeca-2,6-dienyl] methyl carbonate.
| Compound Name | [(2E,6E)-9-[2-(benzenesulfonyl)acetyl]-2,6,9,13-tetramethyl-12-methylidenetetradeca-2,6-dienyl] methyl carbonate |
|---|---|
| PubChem CID | 11168320 |
| Molecular Formula | C29H42O6S |
| Molecular Weight | 518.72 g/mol |
| Exact Mass | 518.27 |
| IUPAC Name | [(2E,6E)-9-[2-(benzenesulfonyl)acetyl]-2,6,9,13-tetramethyl-12-methylidenetetradeca-2,6-dienyl] methyl carbonate |
| SMILES | C=C(CCC(C)(C/C=C(\C)CC/C=C(\C)COC(=O)OC)C(=O)CS(=O)(=O)c1ccccc1)C(C)C |
| InChI | InChI=1S/C29H42O6S/c1-22(2)25(5)17-19-29(6,27(30)21-36(32,33)26-14-9-8-10-15-26)18-16-23(3)12-11-13-24(4)20-35-28(31)34-7/h8-10,13-16,22H,5,11-12,17-21H2,1-4,6-7H3/b23-16+,24-13+ |
| InChIKey | SCZGRCCDTBCSFZ-YQZWSBJXSA-N |
| XLogP | 6.87 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.72 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|