C24H33IO4S — CID 122212401
(4R,5S)-5-(benzenesulfonylmethyl)-4-[(1E,5E)-7-iodo-2,6-dimethylhepta-1,5-dienyl]-2,2-dimethyl-6-methylidene-1,3-dioxepane (PubChem CID 122212401) has the molecular formula C24H33IO4S and a molecular weight of 544.50 g/mol. Its IUPAC name is (4R,5S)-5-(benzenesulfonylmethyl)-4-[(1E,5E)-7-iodo-2,6-dimethylhepta-1,5-dienyl]-2,2-dimethyl-6-methylidene-1,3-dioxepane.
| Compound Name | (4R,5S)-5-(benzenesulfonylmethyl)-4-[(1E,5E)-7-iodo-2,6-dimethylhepta-1,5-dienyl]-2,2-dimethyl-6-methylidene-1,3-dioxepane |
|---|---|
| PubChem CID | 122212401 |
| Molecular Formula | C24H33IO4S |
| Molecular Weight | 544.50 g/mol |
| Exact Mass | 544.11 |
| IUPAC Name | (4R,5S)-5-(benzenesulfonylmethyl)-4-[(1E,5E)-7-iodo-2,6-dimethylhepta-1,5-dienyl]-2,2-dimethyl-6-methylidene-1,3-dioxepane |
| SMILES | C=C1COC(C)(C)O[C@H](/C=C(\C)CC/C=C(\C)CI)[C@H]1CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H33IO4S/c1-18(10-9-11-19(2)15-25)14-23-22(20(3)16-28-24(4,5)29-23)17-30(26,27)21-12-7-6-8-13-21/h6-8,11-14,22-23H,3,9-10,15-17H2,1-2,4-5H3/b18-14+,19-11+/t22-,23+/m0/s1 |
| InChIKey | HKXOCEYMNRVGKB-JMPICLFNSA-N |
| XLogP | 5.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.50 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|