C33H50O6S — CID 134887138
[(E)-9-(benzenesulfonyl)-3,7-dimethyl-8-(oxan-2-yloxy)-9-(2,6,6-trimethylcyclohexen-1-yl)non-2-enyl] acetate (PubChem CID 134887138) has the molecular formula C33H50O6S and a molecular weight of 574.82 g/mol. Its IUPAC name is [(E)-9-(benzenesulfonyl)-3,7-dimethyl-8-(oxan-2-yloxy)-9-(2,6,6-trimethylcyclohexen-1-yl)non-2-enyl] acetate.
| Compound Name | [(E)-9-(benzenesulfonyl)-3,7-dimethyl-8-(oxan-2-yloxy)-9-(2,6,6-trimethylcyclohexen-1-yl)non-2-enyl] acetate |
|---|---|
| PubChem CID | 134887138 |
| Molecular Formula | C33H50O6S |
| Molecular Weight | 574.82 g/mol |
| Exact Mass | 574.33 |
| IUPAC Name | [(E)-9-(benzenesulfonyl)-3,7-dimethyl-8-(oxan-2-yloxy)-9-(2,6,6-trimethylcyclohexen-1-yl)non-2-enyl] acetate |
| SMILES | CC(=O)OC/C=C(\C)CCCC(C)C(OC1CCCCO1)C(C1=C(C)CCCC1(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C33H50O6S/c1-24(20-23-37-27(4)34)14-12-15-26(3)31(39-29-19-10-11-22-38-29)32(30-25(2)16-13-21-33(30,5)6)40(35,36)28-17-8-7-9-18-28/h7-9,17-18,20,26,29,31-32H,10-16,19,21-23H2,1-6H3/b24-20+ |
| InChIKey | LCSXDUWDLCABSL-HIXSDJFHSA-N |
| XLogP | 7.58 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.82 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|