C29H42O6SSi — CID 10721306
[(4aS,5R,8S,9Z,10aR)-5-(benzenesulfonyl)-8-[tert-butyl(dimethyl)silyl]oxy-7,7,10a-trimethyl-4a,5,6,8-tetrahydrobenzo[8]annulen-3-yl] methyl carbonate (PubChem CID 10721306) has the molecular formula C29H42O6SSi and a molecular weight of 546.80 g/mol. Its IUPAC name is [(4aS,5R,8S,9Z,10aR)-5-(benzenesulfonyl)-8-[tert-butyl(dimethyl)silyl]oxy-7,7,10a-trimethyl-4a,5,6,8-tetrahydrobenzo[8]annulen-3-yl] methyl carbonate.
| Compound Name | [(4aS,5R,8S,9Z,10aR)-5-(benzenesulfonyl)-8-[tert-butyl(dimethyl)silyl]oxy-7,7,10a-trimethyl-4a,5,6,8-tetrahydrobenzo[8]annulen-3-yl] methyl carbonate |
|---|---|
| PubChem CID | 10721306 |
| Molecular Formula | C29H42O6SSi |
| Molecular Weight | 546.80 g/mol |
| Exact Mass | 546.25 |
| IUPAC Name | [(4aS,5R,8S,9Z,10aR)-5-(benzenesulfonyl)-8-[tert-butyl(dimethyl)silyl]oxy-7,7,10a-trimethyl-4a,5,6,8-tetrahydrobenzo[8]annulen-3-yl] methyl carbonate |
| SMILES | COC(=O)OC1=C[C@@H]2[C@H](S(=O)(=O)c3ccccc3)CC(C)(C)[C@@H](O[Si](C)(C)C(C)(C)C)/C=C\[C@]2(C)C=C1 |
| InChI | InChI=1S/C29H42O6SSi/c1-27(2,3)37(8,9)35-25-16-18-29(6)17-15-21(34-26(30)33-7)19-23(29)24(20-28(25,4)5)36(31,32)22-13-11-10-12-14-22/h10-19,23-25H,20H2,1-9H3/b18-16-/t23-,24-,25+,29+/m1/s1 |
| InChIKey | RPEKYUVGKVVLCZ-SZSWMCQRSA-N |
| XLogP | 7.06 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.80 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|