C21H34O6SSi — CID 135050285
[3-[1-(benzenesulfonyl)-3,3,3-trimethoxypropyl]cyclohexen-1-yl]oxy-trimethylsilane (PubChem CID 135050285) has the molecular formula C21H34O6SSi and a molecular weight of 442.65 g/mol. Its IUPAC name is [3-[1-(benzenesulfonyl)-3,3,3-trimethoxypropyl]cyclohexen-1-yl]oxy-trimethylsilane.
| Compound Name | [3-[1-(benzenesulfonyl)-3,3,3-trimethoxypropyl]cyclohexen-1-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 135050285 |
| Molecular Formula | C21H34O6SSi |
| Molecular Weight | 442.65 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | [3-[1-(benzenesulfonyl)-3,3,3-trimethoxypropyl]cyclohexen-1-yl]oxy-trimethylsilane |
| SMILES | COC(CC(C1C=C(O[Si](C)(C)C)CCC1)S(=O)(=O)c1ccccc1)(OC)OC |
| InChI | InChI=1S/C21H34O6SSi/c1-24-21(25-2,26-3)16-20(28(22,23)19-13-8-7-9-14-19)17-11-10-12-18(15-17)27-29(4,5)6/h7-9,13-15,17,20H,10-12,16H2,1-6H3 |
| InChIKey | QZPVKXJMWUBDKC-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.65 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|