C23H40O5S — CID 150028851
1-methyl-4-[4-(trimethoxymethyl)dodecylsulfonyl]benzene (PubChem CID 150028851) has the molecular formula C23H40O5S and a molecular weight of 428.64 g/mol. Its IUPAC name is 1-methyl-4-[4-(trimethoxymethyl)dodecylsulfonyl]benzene.
| Compound Name | 1-methyl-4-[4-(trimethoxymethyl)dodecylsulfonyl]benzene |
|---|---|
| PubChem CID | 150028851 |
| Molecular Formula | C23H40O5S |
| Molecular Weight | 428.64 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | 1-methyl-4-[4-(trimethoxymethyl)dodecylsulfonyl]benzene |
| SMILES | CCCCCCCCC(CCCS(=O)(=O)c1ccc(C)cc1)C(OC)(OC)OC |
| InChI | InChI=1S/C23H40O5S/c1-6-7-8-9-10-11-13-21(23(26-3,27-4)28-5)14-12-19-29(24,25)22-17-15-20(2)16-18-22/h15-18,21H,6-14,19H2,1-5H3 |
| InChIKey | DGUZEJVTCRJOFL-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.64 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|