C17H26O4S — CID 138972303
[(E,3R)-3-(2,2-dimethoxyethyl)hept-1-enyl]sulfonylbenzene (PubChem CID 138972303) has the molecular formula C17H26O4S and a molecular weight of 326.46 g/mol. Its IUPAC name is [(E,3R)-3-(2,2-dimethoxyethyl)hept-1-enyl]sulfonylbenzene.
| Compound Name | [(E,3R)-3-(2,2-dimethoxyethyl)hept-1-enyl]sulfonylbenzene |
|---|---|
| PubChem CID | 138972303 |
| Molecular Formula | C17H26O4S |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | [(E,3R)-3-(2,2-dimethoxyethyl)hept-1-enyl]sulfonylbenzene |
| SMILES | CCCC[C@@H](/C=C/S(=O)(=O)c1ccccc1)CC(OC)OC |
| InChI | InChI=1S/C17H26O4S/c1-4-5-9-15(14-17(20-2)21-3)12-13-22(18,19)16-10-7-6-8-11-16/h6-8,10-13,15,17H,4-5,9,14H2,1-3H3/b13-12+/t15-/m0/s1 |
| InChIKey | LBEOEZBRGXSZDX-LHNRBYRGSA-N |
| XLogP | 3.79 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|