C18H28O5S — CID 11142843
2-[1-(benzenesulfonyl)cyclohexyl]-4,4-dimethoxybutan-2-ol (PubChem CID 11142843) has the molecular formula C18H28O5S and a molecular weight of 356.48 g/mol. Its IUPAC name is 2-[1-(benzenesulfonyl)cyclohexyl]-4,4-dimethoxybutan-2-ol.
| Compound Name | 2-[1-(benzenesulfonyl)cyclohexyl]-4,4-dimethoxybutan-2-ol |
|---|---|
| PubChem CID | 11142843 |
| Molecular Formula | C18H28O5S |
| Molecular Weight | 356.48 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 2-[1-(benzenesulfonyl)cyclohexyl]-4,4-dimethoxybutan-2-ol |
| SMILES | COC(CC(C)(O)C1(S(=O)(=O)c2ccccc2)CCCCC1)OC |
| InChI | InChI=1S/C18H28O5S/c1-17(19,14-16(22-2)23-3)18(12-8-5-9-13-18)24(20,21)15-10-6-4-7-11-15/h4,6-7,10-11,16,19H,5,8-9,12-14H2,1-3H3 |
| InChIKey | PKTDBKJVRFIMFZ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.48 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|