C22H30O4S — CID 150908554
4-[2-[2-(3-hydroxy-3-methylbutyl)phenyl]sulfonylphenyl]-2-methylbutan-2-ol (PubChem CID 150908554) has the molecular formula C22H30O4S and a molecular weight of 390.55 g/mol. Its IUPAC name is 4-[2-[2-(3-hydroxy-3-methylbutyl)phenyl]sulfonylphenyl]-2-methylbutan-2-ol.
| Compound Name | 4-[2-[2-(3-hydroxy-3-methylbutyl)phenyl]sulfonylphenyl]-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 150908554 |
| Molecular Formula | C22H30O4S |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 4-[2-[2-(3-hydroxy-3-methylbutyl)phenyl]sulfonylphenyl]-2-methylbutan-2-ol |
| SMILES | CC(C)(O)CCc1ccccc1S(=O)(=O)c1ccccc1CCC(C)(C)O |
| InChI | InChI=1S/C22H30O4S/c1-21(2,23)15-13-17-9-5-7-11-19(17)27(25,26)20-12-8-6-10-18(20)14-16-22(3,4)24/h5-12,23-24H,13-16H2,1-4H3 |
| InChIKey | LBMSUQBGQLKWQL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |