C19H22O4S — CID 138972304
[(E,3R)-1-(benzenesulfonyl)-5,5-dimethoxypent-1-en-3-yl]benzene (PubChem CID 138972304) has the molecular formula C19H22O4S and a molecular weight of 346.45 g/mol. Its IUPAC name is [(E,3R)-1-(benzenesulfonyl)-5,5-dimethoxypent-1-en-3-yl]benzene.
| Compound Name | [(E,3R)-1-(benzenesulfonyl)-5,5-dimethoxypent-1-en-3-yl]benzene |
|---|---|
| PubChem CID | 138972304 |
| Molecular Formula | C19H22O4S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | [(E,3R)-1-(benzenesulfonyl)-5,5-dimethoxypent-1-en-3-yl]benzene |
| SMILES | COC(C[C@H](/C=C/S(=O)(=O)c1ccccc1)c1ccccc1)OC |
| InChI | InChI=1S/C19H22O4S/c1-22-19(23-2)15-17(16-9-5-3-6-10-16)13-14-24(20,21)18-11-7-4-8-12-18/h3-14,17,19H,15H2,1-2H3/b14-13+/t17-/m0/s1 |
| InChIKey | GDZRXKVYMLGZCO-CLVCIHKQSA-N |
| XLogP | 3.77 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|