C21H34O4S — CID 44521254
1-methyl-4-[(E)-4-methyl-1,1-di(propan-2-yloxy)hept-5-en-3-yl]sulfonylbenzene (PubChem CID 44521254) has the molecular formula C21H34O4S and a molecular weight of 382.57 g/mol. Its IUPAC name is 1-methyl-4-[(E)-4-methyl-1,1-di(propan-2-yloxy)hept-5-en-3-yl]sulfonylbenzene.
| Compound Name | 1-methyl-4-[(E)-4-methyl-1,1-di(propan-2-yloxy)hept-5-en-3-yl]sulfonylbenzene |
|---|---|
| PubChem CID | 44521254 |
| Molecular Formula | C21H34O4S |
| Molecular Weight | 382.57 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | 1-methyl-4-[(E)-4-methyl-1,1-di(propan-2-yloxy)hept-5-en-3-yl]sulfonylbenzene |
| SMILES | C/C=C/C(C)C(CC(OC(C)C)OC(C)C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H34O4S/c1-8-9-18(7)20(14-21(24-15(2)3)25-16(4)5)26(22,23)19-12-10-17(6)11-13-19/h8-13,15-16,18,20-21H,14H2,1-7H3/b9-8+ |
| InChIKey | NVPCDANOIVUBPD-CMDGGOBGSA-N |
| XLogP | 4.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.57 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|