C16H24O3S — CID 14608964
(2R,3S)-6-(benzenesulfonyl)-2-[(2S)-butan-2-yl]-3-methyloxane (PubChem CID 14608964) has the molecular formula C16H24O3S and a molecular weight of 296.43 g/mol. Its IUPAC name is (2R,3S)-6-(benzenesulfonyl)-2-[(2S)-butan-2-yl]-3-methyloxane.
| Compound Name | (2R,3S)-6-(benzenesulfonyl)-2-[(2S)-butan-2-yl]-3-methyloxane |
|---|---|
| PubChem CID | 14608964 |
| Molecular Formula | C16H24O3S |
| Molecular Weight | 296.43 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | (2R,3S)-6-(benzenesulfonyl)-2-[(2S)-butan-2-yl]-3-methyloxane |
| SMILES | CC[C@H](C)[C@H]1OC(S(=O)(=O)c2ccccc2)CC[C@@H]1C |
| InChI | InChI=1S/C16H24O3S/c1-4-12(2)16-13(3)10-11-15(19-16)20(17,18)14-8-6-5-7-9-14/h5-9,12-13,15-16H,4,10-11H2,1-3H3/t12-,13-,15?,16+/m0/s1 |
| InChIKey | PAWPWZLVVMYWKN-CMHZKVDGSA-N |
| XLogP | 3.65 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.43 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |