C24H38O6SSi — CID 139182732
[(1R,2R,6S)-2-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxycyclohex-3-en-1-yl]methyl tert-butyl carbonate (PubChem CID 139182732) has the molecular formula C24H38O6SSi and a molecular weight of 482.72 g/mol. Its IUPAC name is [(1R,2R,6S)-2-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxycyclohex-3-en-1-yl]methyl tert-butyl carbonate.
| Compound Name | [(1R,2R,6S)-2-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxycyclohex-3-en-1-yl]methyl tert-butyl carbonate |
|---|---|
| PubChem CID | 139182732 |
| Molecular Formula | C24H38O6SSi |
| Molecular Weight | 482.72 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | [(1R,2R,6S)-2-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxycyclohex-3-en-1-yl]methyl tert-butyl carbonate |
| SMILES | CC(C)(C)OC(=O)OC[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC=C[C@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H38O6SSi/c1-23(2,3)29-22(25)28-17-19-20(30-32(7,8)24(4,5)6)15-12-16-21(19)31(26,27)18-13-10-9-11-14-18/h9-14,16,19-21H,15,17H2,1-8H3/t19-,20+,21-/m1/s1 |
| InChIKey | WQIYTGCWSVXLOF-QHAWAJNXSA-N |
| XLogP | 5.75 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.72 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|