C22H36O4SSi — CID 90821783
[(1S,2S,5R)-3-(benzenesulfonyl)-5-methoxy-2-propan-2-ylcyclohex-3-en-1-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 90821783) has the molecular formula C22H36O4SSi and a molecular weight of 424.68 g/mol. Its IUPAC name is [(1S,2S,5R)-3-(benzenesulfonyl)-5-methoxy-2-propan-2-ylcyclohex-3-en-1-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1S,2S,5R)-3-(benzenesulfonyl)-5-methoxy-2-propan-2-ylcyclohex-3-en-1-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 90821783 |
| Molecular Formula | C22H36O4SSi |
| Molecular Weight | 424.68 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | [(1S,2S,5R)-3-(benzenesulfonyl)-5-methoxy-2-propan-2-ylcyclohex-3-en-1-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CO[C@H]1C=C(S(=O)(=O)c2ccccc2)[C@@H](C(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C22H36O4SSi/c1-16(2)21-19(26-28(7,8)22(3,4)5)14-17(25-6)15-20(21)27(23,24)18-12-10-9-11-13-18/h9-13,15-17,19,21H,14H2,1-8H3/t17-,19+,21+/m1/s1 |
| InChIKey | WQEDSANVDZHXLX-LMNJBCLMSA-N |
| XLogP | 5.43 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.68 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|