C15H20O3S — CID 10356327
[(3S,6S)-6-ethyl-3-methoxycyclohexen-1-yl]sulfonylbenzene (PubChem CID 10356327) has the molecular formula C15H20O3S and a molecular weight of 280.39 g/mol. Its IUPAC name is [(3S,6S)-6-ethyl-3-methoxycyclohexen-1-yl]sulfonylbenzene.
| Compound Name | [(3S,6S)-6-ethyl-3-methoxycyclohexen-1-yl]sulfonylbenzene |
|---|---|
| PubChem CID | 10356327 |
| Molecular Formula | C15H20O3S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | [(3S,6S)-6-ethyl-3-methoxycyclohexen-1-yl]sulfonylbenzene |
| SMILES | CC[C@H]1CC[C@H](OC)C=C1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H20O3S/c1-3-12-9-10-13(18-2)11-15(12)19(16,17)14-7-5-4-6-8-14/h4-8,11-13H,3,9-10H2,1-2H3/t12-,13-/m0/s1 |
| InChIKey | SKWBNJMDLORLHL-STQMWFEESA-N |
| XLogP | 3.18 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |