C14H18O3S — CID 10015780
(1S,4S)-3-(benzenesulfonyl)-4-ethylcyclohex-2-en-1-ol (PubChem CID 10015780) has the molecular formula C14H18O3S and a molecular weight of 266.36 g/mol. Its IUPAC name is (1S,4S)-3-(benzenesulfonyl)-4-ethylcyclohex-2-en-1-ol.
| Compound Name | (1S,4S)-3-(benzenesulfonyl)-4-ethylcyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 10015780 |
| Molecular Formula | C14H18O3S |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | (1S,4S)-3-(benzenesulfonyl)-4-ethylcyclohex-2-en-1-ol |
| SMILES | CC[C@H]1CC[C@H](O)C=C1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H18O3S/c1-2-11-8-9-12(15)10-14(11)18(16,17)13-6-4-3-5-7-13/h3-7,10-12,15H,2,8-9H2,1H3/t11-,12-/m0/s1 |
| InChIKey | HZISSQMZYDGSDK-RYUDHWBXSA-N |
| XLogP | 2.53 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |