C30H44O6SSi — CID 10769221
[(4aS,5R,8S,9Z,10aR)-5-(benzenesulfonyl)-8-[tert-butyl(dimethyl)silyl]oxy-7,7,10a-trimethyl-4a,5,6,8-tetrahydrobenzo[8]annulen-3-yl] ethyl carbonate (PubChem CID 10769221) has the molecular formula C30H44O6SSi and a molecular weight of 560.83 g/mol. Its IUPAC name is [(4aS,5R,8S,9Z,10aR)-5-(benzenesulfonyl)-8-[tert-butyl(dimethyl)silyl]oxy-7,7,10a-trimethyl-4a,5,6,8-tetrahydrobenzo[8]annulen-3-yl] ethyl carbonate.
| Compound Name | [(4aS,5R,8S,9Z,10aR)-5-(benzenesulfonyl)-8-[tert-butyl(dimethyl)silyl]oxy-7,7,10a-trimethyl-4a,5,6,8-tetrahydrobenzo[8]annulen-3-yl] ethyl carbonate |
|---|---|
| PubChem CID | 10769221 |
| Molecular Formula | C30H44O6SSi |
| Molecular Weight | 560.83 g/mol |
| Exact Mass | 560.26 |
| IUPAC Name | [(4aS,5R,8S,9Z,10aR)-5-(benzenesulfonyl)-8-[tert-butyl(dimethyl)silyl]oxy-7,7,10a-trimethyl-4a,5,6,8-tetrahydrobenzo[8]annulen-3-yl] ethyl carbonate |
| SMILES | CCOC(=O)OC1=C[C@@H]2[C@H](S(=O)(=O)c3ccccc3)CC(C)(C)[C@@H](O[Si](C)(C)C(C)(C)C)/C=C\[C@]2(C)C=C1 |
| InChI | InChI=1S/C30H44O6SSi/c1-10-34-27(31)35-22-16-18-30(7)19-17-26(36-38(8,9)28(2,3)4)29(5,6)21-25(24(30)20-22)37(32,33)23-14-12-11-13-15-23/h11-20,24-26H,10,21H2,1-9H3/b19-17-/t24-,25-,26+,30+/m1/s1 |
| InChIKey | ORBXWRPLKLJNDY-OKULBWHXSA-N |
| XLogP | 7.45 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.83 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|