C20H34O4SSi — CID 10476023
[(2S)-1-(benzenesulfonyl)-2-[(4R,5R,6S)-5-methyl-6-propan-2-yl-1,3-dioxan-4-yl]propyl]-trimethylsilane (PubChem CID 10476023) has the molecular formula C20H34O4SSi and a molecular weight of 398.64 g/mol. Its IUPAC name is [(2S)-1-(benzenesulfonyl)-2-[(4R,5R,6S)-5-methyl-6-propan-2-yl-1,3-dioxan-4-yl]propyl]-trimethylsilane.
| Compound Name | [(2S)-1-(benzenesulfonyl)-2-[(4R,5R,6S)-5-methyl-6-propan-2-yl-1,3-dioxan-4-yl]propyl]-trimethylsilane |
|---|---|
| PubChem CID | 10476023 |
| Molecular Formula | C20H34O4SSi |
| Molecular Weight | 398.64 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | [(2S)-1-(benzenesulfonyl)-2-[(4R,5R,6S)-5-methyl-6-propan-2-yl-1,3-dioxan-4-yl]propyl]-trimethylsilane |
| SMILES | CC(C)[C@@H]1OCO[C@@H]([C@H](C)C([Si](C)(C)C)S(=O)(=O)c2ccccc2)[C@@H]1C |
| InChI | InChI=1S/C20H34O4SSi/c1-14(2)18-15(3)19(24-13-23-18)16(4)20(26(5,6)7)25(21,22)17-11-9-8-10-12-17/h8-12,14-16,18-20H,13H2,1-7H3/t15-,16+,18+,19-,20?/m1/s1 |
| InChIKey | QIKQQMLNARDSCQ-ULARDTLWSA-N |
| XLogP | 4.38 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.64 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|