C34H48O5SSi — CID 10438503
[(4R,5S,6S)-8-(benzenesulfonyl)-5-(methoxymethoxy)-4,6-dimethyloctoxy]-tert-butyl-diphenylsilane (PubChem CID 10438503) has the molecular formula C34H48O5SSi and a molecular weight of 596.91 g/mol. Its IUPAC name is [(4R,5S,6S)-8-(benzenesulfonyl)-5-(methoxymethoxy)-4,6-dimethyloctoxy]-tert-butyl-diphenylsilane.
| Compound Name | [(4R,5S,6S)-8-(benzenesulfonyl)-5-(methoxymethoxy)-4,6-dimethyloctoxy]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 10438503 |
| Molecular Formula | C34H48O5SSi |
| Molecular Weight | 596.91 g/mol |
| Exact Mass | 596.30 |
| IUPAC Name | [(4R,5S,6S)-8-(benzenesulfonyl)-5-(methoxymethoxy)-4,6-dimethyloctoxy]-tert-butyl-diphenylsilane |
| SMILES | COCO[C@@H]([C@H](C)CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H](C)CCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C34H48O5SSi/c1-28(33(38-27-37-6)29(2)24-26-40(35,36)30-18-10-7-11-19-30)17-16-25-39-41(34(3,4)5,31-20-12-8-13-21-31)32-22-14-9-15-23-32/h7-15,18-23,28-29,33H,16-17,24-27H2,1-6H3/t28-,29+,33+/m1/s1 |
| InChIKey | BFDRUULMMBVLGI-NCXRXOCASA-N |
| XLogP | 6.47 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.91 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|