C31H39IO5SSi — CID 134844184
2-[(2S,3S,4R,5S)-3-(benzenesulfonylmethyl)-5-(iodomethyl)-4-methoxyoxolan-2-yl]ethoxy-tert-butyl-diphenylsilane (PubChem CID 134844184) has the molecular formula C31H39IO5SSi and a molecular weight of 678.71 g/mol. Its IUPAC name is 2-[(2S,3S,4R,5S)-3-(benzenesulfonylmethyl)-5-(iodomethyl)-4-methoxyoxolan-2-yl]ethoxy-tert-butyl-diphenylsilane.
| Compound Name | 2-[(2S,3S,4R,5S)-3-(benzenesulfonylmethyl)-5-(iodomethyl)-4-methoxyoxolan-2-yl]ethoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 134844184 |
| Molecular Formula | C31H39IO5SSi |
| Molecular Weight | 678.71 g/mol |
| Exact Mass | 678.13 |
| IUPAC Name | 2-[(2S,3S,4R,5S)-3-(benzenesulfonylmethyl)-5-(iodomethyl)-4-methoxyoxolan-2-yl]ethoxy-tert-butyl-diphenylsilane |
| SMILES | CO[C@@H]1[C@@H](CS(=O)(=O)c2ccccc2)[C@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[C@@H]1CI |
| InChI | InChI=1S/C31H39IO5SSi/c1-31(2,3)39(25-16-10-6-11-17-25,26-18-12-7-13-19-26)36-21-20-28-27(30(35-4)29(22-32)37-28)23-38(33,34)24-14-8-5-9-15-24/h5-19,27-30H,20-23H2,1-4H3/t27-,28-,29+,30+/m0/s1 |
| InChIKey | HIVPNVAXYNNHLC-VZNYXHRGSA-N |
| XLogP | 5.26 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.71 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|