C34H44O4S3Si — CID 134847182
2-[(7R)-9-[(2S)-1-(benzenesulfonyl)propan-2-yl]-10-oxa-1,4-dithiaspiro[4.5]decan-7-yl]ethoxy-tert-butyl-diphenylsilane (PubChem CID 134847182) has the molecular formula C34H44O4S3Si and a molecular weight of 641.01 g/mol. Its IUPAC name is 2-[(7R)-9-[(2S)-1-(benzenesulfonyl)propan-2-yl]-10-oxa-1,4-dithiaspiro[4.5]decan-7-yl]ethoxy-tert-butyl-diphenylsilane.
| Compound Name | 2-[(7R)-9-[(2S)-1-(benzenesulfonyl)propan-2-yl]-10-oxa-1,4-dithiaspiro[4.5]decan-7-yl]ethoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 134847182 |
| Molecular Formula | C34H44O4S3Si |
| Molecular Weight | 641.01 g/mol |
| Exact Mass | 640.22 |
| IUPAC Name | 2-[(7R)-9-[(2S)-1-(benzenesulfonyl)propan-2-yl]-10-oxa-1,4-dithiaspiro[4.5]decan-7-yl]ethoxy-tert-butyl-diphenylsilane |
| SMILES | C[C@H](CS(=O)(=O)c1ccccc1)C1C[C@@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CC2(O1)SCCS2 |
| InChI | InChI=1S/C34H44O4S3Si/c1-27(26-41(35,36)29-14-8-5-9-15-29)32-24-28(25-34(38-32)39-22-23-40-34)20-21-37-42(33(2,3)4,30-16-10-6-11-17-30)31-18-12-7-13-19-31/h5-19,27-28,32H,20-26H2,1-4H3/t27-,28-,32?/m1/s1 |
| InChIKey | KSCIFOJGZCAVND-OZIXFKSASA-N |
| XLogP | 6.99 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.01 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|