C33H42O5SSi — CID 134844185
2-[(2S,3S,4R,5R)-3-(benzenesulfonylmethyl)-4-methoxy-5-prop-2-enyloxolan-2-yl]ethoxy-tert-butyl-diphenylsilane (PubChem CID 134844185) has the molecular formula C33H42O5SSi and a molecular weight of 578.85 g/mol. Its IUPAC name is 2-[(2S,3S,4R,5R)-3-(benzenesulfonylmethyl)-4-methoxy-5-prop-2-enyloxolan-2-yl]ethoxy-tert-butyl-diphenylsilane.
| Compound Name | 2-[(2S,3S,4R,5R)-3-(benzenesulfonylmethyl)-4-methoxy-5-prop-2-enyloxolan-2-yl]ethoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 134844185 |
| Molecular Formula | C33H42O5SSi |
| Molecular Weight | 578.85 g/mol |
| Exact Mass | 578.25 |
| IUPAC Name | 2-[(2S,3S,4R,5R)-3-(benzenesulfonylmethyl)-4-methoxy-5-prop-2-enyloxolan-2-yl]ethoxy-tert-butyl-diphenylsilane |
| SMILES | C=CC[C@H]1O[C@@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H](CS(=O)(=O)c2ccccc2)[C@H]1OC |
| InChI | InChI=1S/C33H42O5SSi/c1-6-16-31-32(36-5)29(25-39(34,35)26-17-10-7-11-18-26)30(38-31)23-24-37-40(33(2,3)4,27-19-12-8-13-20-27)28-21-14-9-15-22-28/h6-15,17-22,29-32H,1,16,23-25H2,2-5H3/t29-,30-,31+,32+/m0/s1 |
| InChIKey | VZITVLPWOYTTDG-GASGPIRDSA-N |
| XLogP | 5.40 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.85 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|