C37H52O6SSi2 — CID 11735083
[(2S,3R)-3-(benzenesulfonyl)-3-[[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]methyl]oxiran-2-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 11735083) has the molecular formula C37H52O6SSi2 and a molecular weight of 681.06 g/mol. Its IUPAC name is [(2S,3R)-3-(benzenesulfonyl)-3-[[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]methyl]oxiran-2-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(2S,3R)-3-(benzenesulfonyl)-3-[[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]methyl]oxiran-2-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 11735083 |
| Molecular Formula | C37H52O6SSi2 |
| Molecular Weight | 681.06 g/mol |
| Exact Mass | 680.30 |
| IUPAC Name | [(2S,3R)-3-(benzenesulfonyl)-3-[[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]methyl]oxiran-2-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CCCO[C@@H]1C[C@]1(S(=O)(=O)c2ccccc2)O[C@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C37H52O6SSi2/c1-35(2,3)45(7,8)43-32-25-18-26-40-33(32)27-37(44(38,39)29-19-12-9-13-20-29)34(42-37)28-41-46(36(4,5)6,30-21-14-10-15-22-30)31-23-16-11-17-24-31/h9-17,19-24,32-34H,18,25-28H2,1-8H3/t32-,33+,34-,37+/m0/s1 |
| InChIKey | ZCWGUWXZJZULHH-VABLPFGYSA-N |
| XLogP | 7.09 |
| TPSA | 74.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.06 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|