C26H44O6SSi — CID 10481530
[(2R,3R)-3-(benzenesulfonyl)-3-[6-(oxan-2-yloxy)hexyl]oxiran-2-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 10481530) has the molecular formula C26H44O6SSi and a molecular weight of 512.79 g/mol. Its IUPAC name is [(2R,3R)-3-(benzenesulfonyl)-3-[6-(oxan-2-yloxy)hexyl]oxiran-2-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(2R,3R)-3-(benzenesulfonyl)-3-[6-(oxan-2-yloxy)hexyl]oxiran-2-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10481530 |
| Molecular Formula | C26H44O6SSi |
| Molecular Weight | 512.79 g/mol |
| Exact Mass | 512.26 |
| IUPAC Name | [(2R,3R)-3-(benzenesulfonyl)-3-[6-(oxan-2-yloxy)hexyl]oxiran-2-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@]1(CCCCCCOC1CCCCO1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H44O6SSi/c1-25(2,3)34(4,5)31-21-23-26(32-23,33(27,28)22-15-9-8-10-16-22)18-12-6-7-13-19-29-24-17-11-14-20-30-24/h8-10,15-16,23-24H,6-7,11-14,17-21H2,1-5H3/t23-,24?,26-/m1/s1 |
| InChIKey | QQDMNOYJMBDCHO-SKWHODKYSA-N |
| XLogP | 6.07 |
| TPSA | 74.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.79 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|