C26H46O5SSi — CID 10672964
[(2S,6S)-4-(benzenesulfonyl)-2,6-dimethyl-7-(oxan-2-yloxy)heptoxy]-tert-butyl-dimethylsilane (PubChem CID 10672964) has the molecular formula C26H46O5SSi and a molecular weight of 498.80 g/mol. Its IUPAC name is [(2S,6S)-4-(benzenesulfonyl)-2,6-dimethyl-7-(oxan-2-yloxy)heptoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(2S,6S)-4-(benzenesulfonyl)-2,6-dimethyl-7-(oxan-2-yloxy)heptoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10672964 |
| Molecular Formula | C26H46O5SSi |
| Molecular Weight | 498.80 g/mol |
| Exact Mass | 498.28 |
| IUPAC Name | [(2S,6S)-4-(benzenesulfonyl)-2,6-dimethyl-7-(oxan-2-yloxy)heptoxy]-tert-butyl-dimethylsilane |
| SMILES | C[C@H](COC1CCCCO1)CC(C[C@H](C)CO[Si](C)(C)C(C)(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H46O5SSi/c1-21(19-30-25-15-11-12-16-29-25)17-24(32(27,28)23-13-9-8-10-14-23)18-22(2)20-31-33(6,7)26(3,4)5/h8-10,13-14,21-22,24-25H,11-12,15-20H2,1-7H3/t21-,22-,24?,25?/m0/s1 |
| InChIKey | BSKJYLCDHDKEGB-SCEDHHNCSA-N |
| XLogP | 6.45 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.80 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|