C15H22O4S — CID 11044733
2-[(2S)-3-(benzenesulfonyl)-2-methylpropoxy]oxane (PubChem CID 11044733) has the molecular formula C15H22O4S and a molecular weight of 298.40 g/mol. Its IUPAC name is 2-[(2S)-3-(benzenesulfonyl)-2-methylpropoxy]oxane.
| Compound Name | 2-[(2S)-3-(benzenesulfonyl)-2-methylpropoxy]oxane |
|---|---|
| PubChem CID | 11044733 |
| Molecular Formula | C15H22O4S |
| Molecular Weight | 298.40 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 2-[(2S)-3-(benzenesulfonyl)-2-methylpropoxy]oxane |
| SMILES | C[C@@H](COC1CCCCO1)CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H22O4S/c1-13(11-19-15-9-5-6-10-18-15)12-20(16,17)14-7-3-2-4-8-14/h2-4,7-8,13,15H,5-6,9-12H2,1H3/t13-,15?/m0/s1 |
| InChIKey | FGIGULUSWYWECF-CFMCSPIPSA-N |
| XLogP | 2.64 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |