C22H36O5SSi — CID 10433392
[(4aR,6R,9aS)-2-(benzenesulfonyl)-3,4,4a,6,7,8,9,9a-octahydro-2H-pyrano[3,2-b]oxepin-6-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 10433392) has the molecular formula C22H36O5SSi and a molecular weight of 440.68 g/mol. Its IUPAC name is [(4aR,6R,9aS)-2-(benzenesulfonyl)-3,4,4a,6,7,8,9,9a-octahydro-2H-pyrano[3,2-b]oxepin-6-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(4aR,6R,9aS)-2-(benzenesulfonyl)-3,4,4a,6,7,8,9,9a-octahydro-2H-pyrano[3,2-b]oxepin-6-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10433392 |
| Molecular Formula | C22H36O5SSi |
| Molecular Weight | 440.68 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | [(4aR,6R,9aS)-2-(benzenesulfonyl)-3,4,4a,6,7,8,9,9a-octahydro-2H-pyrano[3,2-b]oxepin-6-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1CCC[C@@H]2OC(S(=O)(=O)c3ccccc3)CC[C@H]2O1 |
| InChI | InChI=1S/C22H36O5SSi/c1-22(2,3)29(4,5)25-16-17-10-9-13-19-20(26-17)14-15-21(27-19)28(23,24)18-11-7-6-8-12-18/h6-8,11-12,17,19-21H,9-10,13-16H2,1-5H3/t17-,19+,20-,21?/m1/s1 |
| InChIKey | RKUNFLLUCGWUTG-IOTSQUBESA-N |
| XLogP | 4.92 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.68 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|