C27H50O5SSi — CID 10346413
[(4R)-13-(benzenesulfonyl)-4-(methoxymethoxy)tridecoxy]-tert-butyl-dimethylsilane (PubChem CID 10346413) has the molecular formula C27H50O5SSi and a molecular weight of 514.85 g/mol. Its IUPAC name is [(4R)-13-(benzenesulfonyl)-4-(methoxymethoxy)tridecoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(4R)-13-(benzenesulfonyl)-4-(methoxymethoxy)tridecoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10346413 |
| Molecular Formula | C27H50O5SSi |
| Molecular Weight | 514.85 g/mol |
| Exact Mass | 514.31 |
| IUPAC Name | [(4R)-13-(benzenesulfonyl)-4-(methoxymethoxy)tridecoxy]-tert-butyl-dimethylsilane |
| SMILES | COCO[C@H](CCCCCCCCCS(=O)(=O)c1ccccc1)CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H50O5SSi/c1-27(2,3)34(5,6)32-22-17-19-25(31-24-30-4)18-13-10-8-7-9-11-16-23-33(28,29)26-20-14-12-15-21-26/h12,14-15,20-21,25H,7-11,13,16-19,22-24H2,1-6H3/t25-/m1/s1 |
| InChIKey | OYYLVGXYJBLKQZ-RUZDIDTESA-N |
| XLogP | 7.37 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.85 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|