C18H32O3SSi — CID 101161742
[(2R)-6-(benzenesulfonyl)hexan-2-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 101161742) has the molecular formula C18H32O3SSi and a molecular weight of 356.60 g/mol. Its IUPAC name is [(2R)-6-(benzenesulfonyl)hexan-2-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(2R)-6-(benzenesulfonyl)hexan-2-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 101161742 |
| Molecular Formula | C18H32O3SSi |
| Molecular Weight | 356.60 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | [(2R)-6-(benzenesulfonyl)hexan-2-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C[C@H](CCCCS(=O)(=O)c1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H32O3SSi/c1-16(21-23(5,6)18(2,3)4)12-10-11-15-22(19,20)17-13-8-7-9-14-17/h7-9,13-14,16H,10-12,15H2,1-6H3/t16-/m1/s1 |
| InChIKey | SECOMWVGFLNQIL-MRXNPFEDSA-N |
| XLogP | 5.04 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.60 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|