C21H38O3SSi — CID 72747865
6-(benzenesulfonyl)hexan-2-yloxy-tri(propan-2-yl)silane (PubChem CID 72747865) has the molecular formula C21H38O3SSi and a molecular weight of 398.69 g/mol. Its IUPAC name is 6-(benzenesulfonyl)hexan-2-yloxy-tri(propan-2-yl)silane.
| Compound Name | 6-(benzenesulfonyl)hexan-2-yloxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 72747865 |
| Molecular Formula | C21H38O3SSi |
| Molecular Weight | 398.69 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | 6-(benzenesulfonyl)hexan-2-yloxy-tri(propan-2-yl)silane |
| SMILES | CC(CCCCS(=O)(=O)c1ccccc1)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C21H38O3SSi/c1-17(2)26(18(3)4,19(5)6)24-20(7)13-11-12-16-25(22,23)21-14-9-8-10-15-21/h8-10,14-15,17-20H,11-13,16H2,1-7H3 |
| InChIKey | LCBVYLHKGJEIRC-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.69 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|