C38H78O8SSi4 — CID 10652942
[(1R,2R,3R)-4-(benzenesulfonyl)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-1-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethoxyethyl]butoxy]-tert-butyl-dimethylsilane (PubChem CID 10652942) has the molecular formula C38H78O8SSi4 and a molecular weight of 807.44 g/mol. Its IUPAC name is [(1R,2R,3R)-4-(benzenesulfonyl)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-1-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethoxyethyl]butoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(1R,2R,3R)-4-(benzenesulfonyl)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-1-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethoxyethyl]butoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10652942 |
| Molecular Formula | C38H78O8SSi4 |
| Molecular Weight | 807.44 g/mol |
| Exact Mass | 806.45 |
| IUPAC Name | [(1R,2R,3R)-4-(benzenesulfonyl)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-1-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethoxyethyl]butoxy]-tert-butyl-dimethylsilane |
| SMILES | COC(OC)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](CS(=O)(=O)c1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C38H78O8SSi4/c1-35(2,3)48(15,16)43-30(28-47(39,40)29-26-24-23-25-27-29)31(44-49(17,18)36(4,5)6)32(45-50(19,20)37(7,8)9)33(34(41-13)42-14)46-51(21,22)38(10,11)12/h23-27,30-34H,28H2,1-22H3/t30-,31-,32+,33-/m0/s1 |
| InChIKey | RLARPTZIFVNHFP-SSNHPIBPSA-N |
| XLogP | 10.64 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.44 |
| LogP ≤ 5 | 10.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|