C24H38O6S — CID 10917440
2-[9-[2-(benzenesulfonylmethyl)-1,3-dioxolan-4-yl]nonoxy]oxane (PubChem CID 10917440) has the molecular formula C24H38O6S and a molecular weight of 454.63 g/mol. Its IUPAC name is 2-[9-[2-(benzenesulfonylmethyl)-1,3-dioxolan-4-yl]nonoxy]oxane.
| Compound Name | 2-[9-[2-(benzenesulfonylmethyl)-1,3-dioxolan-4-yl]nonoxy]oxane |
|---|---|
| PubChem CID | 10917440 |
| Molecular Formula | C24H38O6S |
| Molecular Weight | 454.63 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | 2-[9-[2-(benzenesulfonylmethyl)-1,3-dioxolan-4-yl]nonoxy]oxane |
| SMILES | O=S(=O)(CC1OCC(CCCCCCCCCOC2CCCCO2)O1)c1ccccc1 |
| InChI | InChI=1S/C24H38O6S/c25-31(26,22-14-8-6-9-15-22)20-24-29-19-21(30-24)13-7-4-2-1-3-5-11-17-27-23-16-10-12-18-28-23/h6,8-9,14-15,21,23-24H,1-5,7,10-13,16-20H2 |
| InChIKey | CJRUMGZGGWDASV-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.63 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|