C34H46O5SSi — CID 11061020
tert-butyl-[2-[(2R,7S)-7-(2-methoxyethyl)-4-(4-methylphenyl)sulfonyloxepan-2-yl]ethoxy]-diphenylsilane (PubChem CID 11061020) has the molecular formula C34H46O5SSi and a molecular weight of 594.89 g/mol. Its IUPAC name is tert-butyl-[2-[(2R,7S)-7-(2-methoxyethyl)-4-(4-methylphenyl)sulfonyloxepan-2-yl]ethoxy]-diphenylsilane.
| Compound Name | tert-butyl-[2-[(2R,7S)-7-(2-methoxyethyl)-4-(4-methylphenyl)sulfonyloxepan-2-yl]ethoxy]-diphenylsilane |
|---|---|
| PubChem CID | 11061020 |
| Molecular Formula | C34H46O5SSi |
| Molecular Weight | 594.89 g/mol |
| Exact Mass | 594.28 |
| IUPAC Name | tert-butyl-[2-[(2R,7S)-7-(2-methoxyethyl)-4-(4-methylphenyl)sulfonyloxepan-2-yl]ethoxy]-diphenylsilane |
| SMILES | COCC[C@@H]1CCC(S(=O)(=O)c2ccc(C)cc2)C[C@@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C34H46O5SSi/c1-27-16-19-30(20-17-27)40(35,36)31-21-18-28(22-24-37-5)39-29(26-31)23-25-38-41(34(2,3)4,32-12-8-6-9-13-32)33-14-10-7-11-15-33/h6-17,19-20,28-29,31H,18,21-26H2,1-5H3/t28-,29+,31?/m0/s1 |
| InChIKey | XDQBGRPARQZWQW-SECPYKCTSA-N |
| XLogP | 6.08 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.89 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|