C24H34O4SSi — CID 10433715
[(2R,3R)-3-(benzenesulfonyl)-3-(3-phenylpropyl)oxiran-2-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 10433715) has the molecular formula C24H34O4SSi and a molecular weight of 446.69 g/mol. Its IUPAC name is [(2R,3R)-3-(benzenesulfonyl)-3-(3-phenylpropyl)oxiran-2-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(2R,3R)-3-(benzenesulfonyl)-3-(3-phenylpropyl)oxiran-2-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10433715 |
| Molecular Formula | C24H34O4SSi |
| Molecular Weight | 446.69 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | [(2R,3R)-3-(benzenesulfonyl)-3-(3-phenylpropyl)oxiran-2-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@]1(CCCc1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H34O4SSi/c1-23(2,3)30(4,5)27-19-22-24(28-22,18-12-15-20-13-8-6-9-14-20)29(25,26)21-16-10-7-11-17-21/h6-11,13-14,16-17,22H,12,15,18-19H2,1-5H3/t22-,24-/m1/s1 |
| InChIKey | QBRHPXWEINIHQI-ISKFKSNPSA-N |
| XLogP | 5.60 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.69 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|