C23H38O5SSi — CID 134955124
tert-butyl-[(2S,3R,5S,6R)-5,6-dimethyl-2-[[(2R,3R)-3-(4-methylphenyl)sulfonyloxiran-2-yl]methyl]oxan-3-yl]oxy-dimethylsilane (PubChem CID 134955124) has the molecular formula C23H38O5SSi and a molecular weight of 454.71 g/mol. Its IUPAC name is tert-butyl-[(2S,3R,5S,6R)-5,6-dimethyl-2-[[(2R,3R)-3-(4-methylphenyl)sulfonyloxiran-2-yl]methyl]oxan-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2S,3R,5S,6R)-5,6-dimethyl-2-[[(2R,3R)-3-(4-methylphenyl)sulfonyloxiran-2-yl]methyl]oxan-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 134955124 |
| Molecular Formula | C23H38O5SSi |
| Molecular Weight | 454.71 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | tert-butyl-[(2S,3R,5S,6R)-5,6-dimethyl-2-[[(2R,3R)-3-(4-methylphenyl)sulfonyloxiran-2-yl]methyl]oxan-3-yl]oxy-dimethylsilane |
| SMILES | Cc1ccc(S(=O)(=O)[C@H]2O[C@@H]2C[C@@H]2O[C@H](C)[C@@H](C)C[C@H]2O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C23H38O5SSi/c1-15-9-11-18(12-10-15)29(24,25)22-21(27-22)14-19-20(13-16(2)17(3)26-19)28-30(7,8)23(4,5)6/h9-12,16-17,19-22H,13-14H2,1-8H3/t16-,17+,19-,20+,21+,22+/m0/s1 |
| InChIKey | DTFAQXUBBUCSCF-QRGGPHLOSA-N |
| XLogP | 5.09 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.71 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|