C20H34O5SSi — CID 134834320
[(2S,4R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-methyloxan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 134834320) has the molecular formula C20H34O5SSi and a molecular weight of 414.64 g/mol. Its IUPAC name is [(2S,4R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-methyloxan-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2S,4R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-methyloxan-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 134834320 |
| Molecular Formula | C20H34O5SSi |
| Molecular Weight | 414.64 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | [(2S,4R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-methyloxan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H]2C[C@H](O[Si](C)(C)C(C)(C)C)C[C@H](C)O2)cc1 |
| InChI | InChI=1S/C20H34O5SSi/c1-15-8-10-19(11-9-15)26(21,22)23-14-18-13-17(12-16(2)24-18)25-27(6,7)20(3,4)5/h8-11,16-18H,12-14H2,1-7H3/t16-,17+,18-/m0/s1 |
| InChIKey | HKKHHYGOGCJNEZ-KSZLIROESA-N |
| XLogP | 4.66 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.64 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|